Daunorubicin citrate
Daunorubicin citrate is a topoisomerase II inhibitor that intercalates into DNA and interacts with topoisomerase II, thereby inhibiting DNA replication and repair RNA and protein synthesis. It is used to treat cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01360 |
| Pricing | Inquire |
| Cas | 1884557-85-0 |
| Molecular Weight | 719.64 |
| Molecular Formula | C33H37NO17 |
| Canonical SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)C)O)N)O.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |