5,5'-Thiodisalicylic Acid
5,5'-Thiodisalicylic Acid is a prominent compound in the biomedical field and exhibits remarkable indispensability for the cultivation of pharmaceutical treatments that aim to counteract inflammatory disorders and autoimmune afflictions. The distinctive configuration of its chemical composition enables it to proficiently impede specific enzymes intricately linked to these distressing maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1820-99-1 |
| Pricing | Inquire |
| Cas | 1820-99-1 |
| Molecular Weight | 306.29 |
| Molecular Formula | C14H10O6S |
| Canonical SMILES | C1=CC(=C(C=C1SC2=CC(=C(C=C2)O)C(=O)O)C(=O)O)O |