Cyanocobalamin Impurity F
Cyanocobalamin Impurity F is an impurity of Vitamin B12, which is a water-soluble vitamin with a key role in the normal functioning of the brain and nervous system, and for the formation of blood.
Supplier | BOC Sciences |
---|---|
Product # | B1370-469493 |
Pricing | Inquire |
Cas | 23208-66-4 |
Molecular Weight | 1354.33 |
Molecular Formula | C63H85CoN13O15P |
Canonical SMILES | CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)([O-])OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=N6)C(=C7C8(CC(=O)OC8(C(=N7)C=C9C(C(C(=N9)C(=C4[N-]5)C)CCC(=O)N)(C)C)CCC(=O)N)C)C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+3] |