9-O-(6-O-Malonyl-β-D-glucopyranosyl) Alternariol
9-O-(6-O-Malonyl-β-D-glucopyranosyl) Alternariol is a derivative of Alternariol which is an alternaria mycotoxin and genotoxin, found in common edible crops. Alternariol inhibits the activity of various DNA-topoisomerases, increasing the rate of DNA strand breaks. Alternariol 3- Sulfate Ammonium Salt is currently suspected of being formed during metabolism in contaminated plants.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1779520-66-9 |
| Pricing | Inquire |
| Cas | 1779520-66-9 |
| Molecular Weight | 506.41 |
| Molecular Formula | C23H22O13 |
| Canonical SMILES | CC1=CC(=CC2=C1C3=C(C(=CC(=C3)OC4C(C(C(C(O4)COC(=O)CC(=O)O)O)O)O)O)C(=O)O2)O |