1,2,3,6-Tetra-O-benzoyl-b-D-mannopyranose
1,2,3,6-Tetra-O-benzoyl-b-D-mannopyranose is a carbohydrate moiety harnessed for glycoconjugate biosynthesis - molecules bearing carbohydrates linked covalently to proteins or lipids. Frequently utilized for the synthesis of glycopeptides and glycolipids, these play pivotal roles in the exploration of infectious ailments and neoplasms. The molecule's intricate structure confers a lasting impact on the formation and investigation of biologically relevant chemical compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | 171482-60-3 |
| Pricing | Inquire |
| Cas | 171482-60-3 |
| Molecular Weight | 596.58 |
| Molecular Formula | C34H28O10 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)O |