Fmoc-N-Me-Lys(ivDde)-OH
Fmoc-N-Me-Lys(ivDde)-OH, an important lysine derivative in peptide synthesis, serves as a fundamental constituent of peptides that target prevalent pathologies such as cancer, diabetes, and cardiovascular disease. Its distinctive nature as a protected amino acid holds significant advantages in research and drug development since it provides peptide molecules with specific, biologically active properties. This feature results in the generation of a diverse range of desirable outcomes for innovative therapeutics and potential cures.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008735 |
| Pricing | Inquire |
| Cas | 1173996-67-2 |
| Molecular Weight | 588.73 |
| Molecular Formula | C35H44N2O6 |
| Canonical SMILES | CC(C)CC(=NCCCCC(C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C4=C(CC(CC4=O)(C)C)O |