Defluoro Linezolid-[d3]
Defluoro Linezolid-[d3], is the labelled analogue of Defluoro Linezolid, which is an impurity of Linezolid. Linezolid is an antibiotic used for the treatment of infections caused by Gram-positive bacteria that are resistant to other antibiotics.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002462 |
| Pricing | Inquire |
| Cas | 1795786-92-3 |
| Molecular Weight | 322.37 |
| Molecular Formula | C16H18D3N3O4 |
| Canonical SMILES | CC(=O)NCC1CN(C(=O)O1)C2=CC=C(C=C2)N3CCOCC3 |