1,3,4,6-Tetra-O-acetyl-N-azidoacetylglucosamine
1,3,4,6-Tetra-O-acetyl-N-azidoacetylglucosamine, a vital compound employed in biomedical research, serves as an indispensable intermediate. It finds extensive utility in synthesizing glycosylated biomolecules, including glycopeptides and glycoproteins. Possessing an azido functional group, this compound facilitates efficient bioconjugation and labeling investigations. Its versatility stretches to the exploration of cell surface glycans, glycosylation pathways, and glycoengineering. Additionally, it aids in examining cell-surface interactions and potential therapeutic interventions associated with anomalous glycosylation, thereby contributing significantly to the realm of disease management.
| Supplier | BOC Sciences |
|---|---|
| Product # | 98924-81-3 |
| Pricing | Inquire |
| Cas | 98924-81-3 |
| Molecular Weight | 430.37 |
| Molecular Formula | C16H22N4O10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C |