N-Acetyl-S-(3-carboxy-2-propyl)-L-cysteine Disodium Salt (Mixture of Diastereomers)
N-Acetyl-S-(3-carboxy-2-propyl)-L-cysteine Disodium Salt (Mixture of Diastereomers) is a renowned biomedical compound, garnering attention in studying kidney and liver afflictions. It has inherent aptitude to moderate oxidative stress and impede inflammatory reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1041285-62-4 |
| Pricing | Inquire |
| Cas | 1041285-62-4 |
| Molecular Weight | 293.25 |
| Molecular Formula | C9H13NNa2O5S |
| Canonical SMILES | CC(CC(=O)[O-])SCC(C(=O)[O-])NC(=O)C.[Na+].[Na+] |