((2S,3S,4S,5S)-3-(benzoyloxy)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-fluoro-4-methyltetrahydrofuran-2-yl)methyl benzoate
(2S,3S,4S,5S)-3-(benzoyloxy)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-fluoro-4-methyltetrahydrofuran-2-yl)methyl benzoate, a biomedically significant compound, plays a crucial role in the creation of drugs aimed at combating a myriad of ailments including cancer, bacterial infections, and inflammatory disorders. Its remarkable ability to impede certain enzymes and receptors within the body has facilitated its widespread use in pharmaceutical development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1946820-95-6 |
| Pricing | Inquire |
| Cas | 1946820-95-6 |
| Molecular Weight | 468.43 |
| Molecular Formula | C24H21FN2O7 |
| Canonical SMILES | CC1(C(C(OC1N2C=CC(=O)NC2=O)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)F |