Diphenylphosphinic acid
Diphenylphosphinic acid (CAS# 1707-03-5) is used as an active ingredient in the preparation of highly efficient flame-retardant melanine salt (DPPMA). It also functions as a reagent for the asymmetric pilot-scale synthesis of TV-45070, a chiral spiro-ether that has a potential for topical pain therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1707-03-5 |
| Pricing | Inquire |
| Cas | 1707-03-5 |
| Molecular Weight | 218.19 |
| Molecular Formula | C12H11O2P |
| Canonical SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)O |