4-Nitrophenyl 2-acetamido-2-deoxy-3-O-[2-O-(a-L-fucopyranosyl)-b-D-galactopyranosyl]-b-D-glucopyranoside
4-Nitrophenyl 2-acetamido-2-deoxy-3-O-[2-O-(α-L-fucopyranosyl)-β-D-galactopyranosyl]-β-D-glucopyranoside, an indispensable biochemical compound, finds extensive utility in biomedicine. Its paramount role lies in serving as a substrate for diverse enzymes implicated in drug metabolism and toxicity investigations. Moreover, it is an established tool in glycosylation research and acts as a potent labeling agent to ascertain intricate carbohydrate structures with precision.
| Supplier | BOC Sciences |
|---|---|
| Product # | 93496-53-8 |
| Pricing | Inquire |
| Cas | 93496-53-8 |
| Molecular Weight | 650.58 |
| Molecular Formula | C26H38N2O17 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3C(C(OC(C3O)CO)OC4=CC=C(C=C4)[N+](=O)[O-])NC(=O)C)CO)O)O)O)O)O |