D-Galactofuranose, 1,2,3,5,6-pentabenzoate
D-Galactofuranose, 1,2,3,5,6-pentabenzoate is a synthetic compound commonly used in the biomedical industry. It exhibits potential as a targeted drug delivery system for the treatment of various diseases, including cancer. Through extensive research, this compound has shown promising results in drug development and precision medicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 138811-45-7 |
| Pricing | Inquire |
| Cas | 138811-45-7 |
| Molecular Weight | 700.69 |
| Molecular Formula | C41H32O11 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC(CC2C(C(C(O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |