KP372-1
KP372-1 is a synthetic small molecule AKT inhibitor. KP372-1 is consisted of two isomers: KP372-1A and KP372-1B. KP372-1 showed activities to block signalling downstream of Akt in thyroid tumour cells, leading to inhibition of cell proliferation and increased apoptosis. KP372-1 has also been shown to suppress cell proliferation and induce apoptosis in gliobastoma.
| Supplier | BOC Sciences |
|---|---|
| Product # | 329710-24-9 |
| Pricing | Inquire |
| Cas | 329710-24-9 |
| Molecular Weight | 224.18 |
| Molecular Formula | C10H4N6O |
| Canonical SMILES | C1=CC=C2C(=C1)C3=NN4C(=NN=N4)N=C3C2=O |