Malabaricone B
Malabaricone B is a natural compound derived from a natural source unveiling remarkable attributes as an antioxidant and anti-inflammatory attributes, spearheading the research of an assortment of maladies, encompassing cancer, cardiovascular disorders and neurodegenerative conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 63335-24-0 |
| Pricing | Inquire |
| Cas | 63335-24-0 |
| Molecular Weight | 342.43 |
| Molecular Formula | C21H26O4 |
| Canonical SMILES | C1=CC(=C(C(=C1)O)C(=O)CCCCCCCCC2=CC=C(C=C2)O)O |