Dideoxy-amanitin
Dideoxy-amanitin is an α-Amanitin derivative. α-Amanitin is an extremely toxic bicyclic octapeptide isolated from the death-cap mushroom, Amanita phalloides. As a potent inhibitor of RNA polymerase II, α-amanitin is toxic to eukaryotic cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01363 |
| Pricing | Inquire |
| Cas | 58255-46-2 |
| Molecular Weight | 886.97 |
| Molecular Formula | C39H54N10O12S |
| Canonical SMILES | CCC(C)C1C(=O)NCC(=O)NC2CSC3=C(CC(C(=O)NCC(=O)N1)NC(=O)C(NC(=O)C4CC(CN4C(=O)C(NC2=O)CC(=O)N)O)C(C)C(CO)O)C5=CC=CC=C5N3 |