Methyl 2-(6-Hydroxy-2,3-dihydrobenzofuran-3-yl)acetate
(6-Hydroxy-2,3-dihydrobenzofuran-3-yl)acetic Acid Methyl Ester was used in the synthetic preparation of TAK-875 (T004915), a novel oral medication that has been developed to improve the secretion of insulin in a glucose-dependent manner, which has the potential to improve the control of blood sugar levels without the risk of hypoglycemia.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB036519 |
| Pricing | Inquire |
| Cas | 805250-17-3 |
| Molecular Weight | 208.21 |
| Molecular Formula | C11H12O4 |
| Canonical SMILES | COC(=O)CC1COC2=C1C=CC(=C2)O |