N2-iso-Butyroyl-5'-O-(4,4'-dimethoxytrityl)-3'-O-(methoxyethyl)guanosine
N2-iso-Butyroyl-5'-O-(4,4'-dimethoxytrityl)-3'-O-(methoxyethyl)guanosine, a remarkable biomedical compound, showcases its potency as an antiviral marvel combating RNA virus-induced infections. Its mode of action resides in the adeptness to quell viral replication through the targeting of viral enzymes or disruption of viral protein synthesis. Remarkably versatile, this product assumes the role of a catalyzing agent in pioneering antiviral treatments and serves as a formidable investigative instrument in the realm of virology research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 256224-05-2 |
| Pricing | Inquire |
| Cas | 256224-05-2 |
| Molecular Weight | 713.78 |
| Molecular Formula | C38H43N5O9 |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OCCOC)O |