2',3-Bis[[3-[3,5-di-tert-butyl-4-hydroxyphenyl]propionyl]]propionohydrazide
2',3-Bis[[3-[3,5-di-tert-butyl-4-hydroxyphenyl]propionyl]]propionohydrazide is an effective oxidative defense agent. Its practical use is closely related to the prevention of neurodegenerative diseases (Alzheimer's and Parkinson's diseases) due to its inherent neuroprotective properties that effectively combat oxidative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 32687-78-8 |
| Pricing | Inquire |
| Cas | 32687-78-8 |
| Molecular Weight | 552.8 |
| Molecular Formula | C34H52N2O4 |
| Canonical SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)NNC(=O)CCC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |