CP 31398
CP 31398 is a p53 stabilizer and could probably restrain the growth of small human tumor xenografts in vivo. CP 31398 is a prototype small molecule that stabilizes the active conformation of p53 and promotes p53 activity in cancer cell lines with mutant or wild-type p53.
| Supplier | BOC Sciences |
|---|---|
| Product # | 259199-65-0 |
| Pricing | Inquire |
| Cas | 259199-65-0 |
| Molecular Weight | 362.47 |
| Molecular Formula | C22H26N4O |
| Canonical SMILES | CN(C)CCCNC1=NC(=NC2=CC=CC=C21)C=CC3=CC=C(C=C3)OC |