CHCC Acid
CHCC Acid is an amine-reactive, blue-fluorescent dye used for labeling biomolecules such as peptides, proteins, modified nucleotides and biopolymers. CHCC may also be used as a building block in the synthesis of unique enzyme substrates and as a reference standard for enzymatic substrates synthesized from CHCC dye.
| Supplier | BOC Sciences |
|---|---|
| Product # | 183736-74-5 |
| Pricing | Inquire |
| Cas | 183736-74-5 |
| Molecular Weight | 240.6 |
| Molecular Formula | C10H5ClO5 |
| Canonical SMILES | C1=C2C=C(C(=O)OC2=CC(=C1Cl)O)C(=O)O |