SN 003
SN 003 is a reversible corticotropin releasing factor receptor 1 (CRF1) antagonist (Ki = 3.4 and 7.9 nM at rat and human CRF1, respectively) that displays >1000-fold selectivity over CRF2 receptors. SN 003 was shown to inhibit CRF-induced ACTH release in vitro (IC50 = 241 nM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 197801-88-0 |
| Pricing | Inquire |
| Cas | 197801-88-0 |
| Molecular Weight | 355.43 |
| Molecular Formula | C19H25N5O2 |
| Canonical SMILES | CCC(COC)N1C2=CC(=NC(=C2N=N1)NC3=C(C=C(C=C3)OC)C)C |