3,4,6-Tri-O-acetyl-N-azidoacetylmannosamine
3,4,6-Tri-O-acetyl-N-azidoacetylmannosamine, a significant compound employed in the field of biomedicine, assumes an indispensable function in the chemical alteration of therapeutic pharmaceuticals. Its pivotal role emerges particularly in the treatment of ailments connected to the synthesis and modification of carbohydrates. This compound, acting as a fundamental reagent, contributes significantly to the advancement of targeted therapeutic strategies for a multitude of afflictions such as cancer and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2231742-57-5 |
| Pricing | Inquire |
| Cas | 2231742-57-5 |
| Molecular Weight | 388.33 |
| Molecular Formula | C14H20N4O9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)O)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C |