Cyclobuxine D
Cyclobuxine D is a steroidal alkaloid extracted from Buxus microphylla. It has obvious bradycardia effect on rat heart, and inhibits acetylcholine and Ba ++ induced longitudinal muscle contraction isolated from rabbit jejunum.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2241-90-9 |
| Pricing | Inquire |
| Cas | 2241-90-9 |
| Molecular Weight | 386.61 |
| Molecular Formula | C25H42N2O |
| Canonical SMILES | CC(C1C(CC2(C1(CCC34C2CCC5C3(C4)CCC(C5=C)NC)C)C)O)NC |