5-Fluoropolyoxin M
It is produced by the strain of Streptomyces cacoi. 5-Fluoropolyoxin L has the inhibitory activity of Escherichia coli and Streptococcus faecalis, and the antibacterial activity of 5-Fluoropolyoxin M is lower than L.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01422 |
| Pricing | Inquire |
| Cas | 50355-68-5 |
| Molecular Weight | 479.37 |
| Molecular Formula | C16H22FN5O11 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)C(C(=O)O)NC(=O)C(CC(COC(=O)N)O)N)O)O)F |