4-Cyanobenzylzinc bromide solution
4-Cyanobenzylzinc bromide solution is a valuable reagent extensively used in biomedicine. It serves as a versatile tool for the synthesis and modification of pharmaceutical molecules. With its unique properties, this solution is employed in the preparation of anti-inflammatory drugs and antiviral agents, addressing various diseases such as rheumatoid arthritis and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 135579-87-2 |
| Pricing | Inquire |
| Cas | 135579-87-2 |
| Molecular Weight | 261.43 |
| Molecular Formula | C8H6BrNZn |
| Canonical SMILES | [CH2-]C1=CC=C(C=C1)C#N.[Zn+2].[Br-] |