Spinosyn D 17-pseudoaglycone
It is an acid degradation product produced by selective hydrolysis of the more labile forosamine saccharide in the 17-position in spinosyn D. It has only weak activity as an insecticide as the forosamine moiety is considered essential for potent activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04290 |
| Pricing | Inquire |
| Cas | 131929-55-0 |
| Molecular Weight | 604.77 |
| Molecular Formula | C34H52O9 |
| Canonical SMILES | CCC1CCCC(C(C(=O)C2=CC3C4CC(CC4C(=CC3C2CC(=O)O1)C)OC5C(C(C(C(O5)C)OC)OC)OC)C)O |