5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside
5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside is a biochemical compound widely used in biomedicine. It serves as a substrate for detecting the presence of the β-glucosidase enzyme, commonly found in various organisms. This compound plays a crucial role in studying enzyme kinetics, drug development, and understanding physiological processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15548-60-4 |
| Pricing | Inquire |
| Cas | 15548-60-4 |
| Molecular Weight | 408.63 |
| Molecular Formula | C14H15BrClNO6 |
| Canonical SMILES | C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)CO)O)O)O)Cl)Br |