Fmoc-Amido-Tri-(carboxyethoxymethyl)-methane
Fmoc-Amido-Tri-(carboxyethoxymethyl)-methane is a multifunctional reagent containing three carboxylic acids and a primary amine that is Fmoc-protected. The carboxylic acids can react with primary amine groups to form stable amide bonds. The Fmoc protecting group can be removed using piperidine, freeing up the amine for a variety of uses such as coupling with carboxylic acids to form amide bonds.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-4166 |
| Pricing | Inquire |
| Cas | 1240500-35-9 |
| Molecular Weight | 559.6 |
| Molecular Formula | C28H33NO11 |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(COCCC(=O)O)(COCCC(=O)O)COCCC(=O)O |