a-D-Glucose-1-phosphate disodium salt hydrate
a-D-Glucose-1-phosphate disodium salt hydrate is a key compound used in biomedicine for the research of glycogen storage diseases, specifically those resulting from defects in the glucose-6-phosphatase enzyme. By providing exogenous glucose-1-phosphate, it aids in bypassing the enzyme deficiency and replenishing glucose levels, addressing the associated symptoms and complications of these diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 56401-20-8 |
| Pricing | Inquire |
| Cas | 56401-20-8 |
| Molecular Weight | 304.10 (anydrous basis) |
| Molecular Formula | C6H11O9P.2Na.xH2O |
| Canonical SMILES | C(C1C(C(C(C(O1)OP(=O)([O-])[O-])O)O)O)O.[Na+].[Na+] |