Inosine-3',5'-cyclic-monophosphate
Inosine-3',5'-cyclic-monophosphate, a multifaceted signaling molecule, participates in diverse physiological processes including muscle contraction, neurotransmission, and ion channel regulation. This intriguing biomolecule has captivated scientific attention for its prospective therapeutic applications in neurological disorders, cardiovascular pathologies, and malignant conditions. Its aptitude in promoting neuroprotection and augmenting synaptic plasticity renders it a fascinating candidate for tackling the symptoms of Alzheimer's and various other neurodegenerative afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3545-76-4 |
| Pricing | Inquire |
| Cas | 3545-76-4 |
| Molecular Weight | 330.19 |
| Molecular Formula | C10H11N4O7P |
| Canonical SMILES | C1C2C(C(C(O2)N3C=NC4=C3N=CNC4=O)O)OP(=O)(O1)O |