Phenyl 2,6-di-O-acetyl-3,4-O-isopropylidene-b-D-thiogalactopyranoside
Phenyl 2,6-di-O-acetyl-3,4-O-isopropylidene-b-D-thiogalactopyranoside stands as a pivotal compound assuming the role of a substrate analog, enabling the research of enzymatic reactions related to the synthesis of bacterial cell walls. Widely employed in research, its proficiency lies in hindering ß-galactosidase activity, hence emerging as an invaluable instrument for investigating gene expression and protein functionality across a diverse array of biological systems.
| Supplier | BOC Sciences |
|---|---|
| Product # | 124476-99-9 |
| Pricing | Inquire |
| Cas | 124476-99-9 |
| Molecular Weight | 396.5 |
| Molecular Formula | C19H24O7S |
| Canonical SMILES | CC(=O)OCC1C2C(C(C(O1)SC3=CC=CC=C3)OC(=O)C)OC(O2)(C)C |