D-Glucuronic acid
D-Glucuronic acid is widely distributed in the plant and animal kingdoms. The glucuronides present in normal urine are those of phenol, cresol, and indoxyl. After the ingestion of poisons such as morphine, chloral hydrate, camphor, or turpentine, glucuronides formed with the poison or its hydroxylated derivatives appear in the urine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6556-12-3 |
| Pricing | Inquire |
| Cas | 6556-12-3 |
| Molecular Weight | 194.14 |
| Molecular Formula | C6H10O7 |
| Canonical SMILES | C1(C(C(OC(C1O)O)C(=O)O)O)O |