D-His-OMe 2HCl
D-Histidine methyl ester is a protected form of D-Histidine. D-Histidine is the unnatural, biologically inactive isomer of L-Histidine. D-histidine is known to inhibit cell division, and is also used by certain types of bacteria (such as Escherichia coli) as a source of L-Histidine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4467-54-3 |
| Pricing | Inquire |
| Cas | 4467-54-3 |
| Molecular Weight | 242.11 |
| Molecular Formula | C7H11N3O2ยท2HCl |
| Canonical SMILES | COC(=O)C(CC1=CN=CN1)N.Cl.Cl |