Lapatinib-[d7] Ditosylate
Lapatinib-[d7] Ditosylat is the labelled salt of Lapatinib, which has potential antineoplastic activity. Lapatinib reversibly blocks phosphorylation of the epidermal growth factor receptor (EGFR), ErbB2, and the Erk-1 and-2 and AKT kinases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011924 |
| Pricing | Inquire |
| Cas | 1009307-24-7 |
| Molecular Weight | 932.5 |
| Molecular Formula | C43H35D7ClFN4O10S3 |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CS(=O)(=O)CCNCC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl |