Tubulin inhibitor 7
Tubulin inhibitor 7 is a tubulin inhibitor. Tubulin inhibitor 7 inhibits tubulin polymerization with an IC50 of 0.52 μM. Tubulin inhibitor 7 inhibits K562 cell growth with an IC50 of 11 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1309925-41-4 |
| Pricing | Inquire |
| Cas | 1309925-41-4 |
| Molecular Weight | 358.35 |
| Molecular Formula | C21H14N2O4 |
| Canonical SMILES | COC1=C(C=C(C=C1)C(=O)N2C3=C(C=C(C=C3)C#N)OC4=CC=CC=C42)O |