Oenothein B
Oenothein B is a dimeric macrocyclic ellagitannin with a wide range of pharmacological activities, including antioxidant, anti-inflammatory, anti-fungal, anti-HCV and anti-tumor properties. It is an effective and specific inhibitor of poly(ADP-ribose) glycohydrolase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 104987-36-2 |
| Pricing | Inquire |
| Cas | 104987-36-2 |
| Molecular Weight | 1569.08 |
| Molecular Formula | C68H48O44 |
| Canonical SMILES | C1C2C3C(C(C(O2)O)OC(=O)C4=CC(=C(C(=C4OC5=C(C(=C6C(=C5)C(=O)OCC7C(C(C(C(O7)O)OC(=O)C8=CC(=C(C(=C8OC9=C(C(=C(C(=C9)C(=O)O3)C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C16)O)O)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O |