Tapentadol-β-D-glucuronide solution
One of the impurities of Tapentadol, which is a centrally acting analgesic agent.
Narcotic Licence Schedule A (Switzerland); estupefaciente (Spain); Decreto Lei 15/93: Tabela IA (Portugal)
Narcotic Licence Schedule A (Switzerland); estupefaciente (Spain); Decreto Lei 15/93: Tabela IA (Portugal)
| Supplier | BOC Sciences |
|---|---|
| Product # | 1300037-86-8 |
| Pricing | Inquire |
| Cas | 1300037-86-8 |
| Molecular Weight | 397.47 |
| Molecular Formula | C20H31NO7 |
| Canonical SMILES | CCC(C1=CC(=CC=C1)OC2C(C(C(C(O2)C(=O)O)O)O)O)C(C)CN(C)C |