1-Alaninechlamydocin
It is a cyclic tetrapeptide antibiotic containing a single β-amino acid, which was isolated from diheterospora chlamydosporia in 1992. It is less widely characterised than the related chlamydocin. It exhibits potent antitumor activity and acts by inhibiting histone deacetylase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 141446-96-0 |
| Pricing | Inquire |
| Cas | 141446-96-0 |
| Molecular Weight | 512.61 |
| Molecular Formula | C27H36N4O6 |
| Canonical SMILES | CC1C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)N1)CCCCCC(=O)C3CO3)CC4=CC=CC=C4 |