Nitidine chloride
Nitidine chloride, that comes from the roots of Zanthoxylum nitidum (Roxb.) DC, could be developed as a potential anticancer agent to renal cancer and worthy of further studies. Nitidine chloride inhibited the proliferation of SMMC-7721 cells in vitro in a time- and dose-dependent manner and identified efficacy in vivo in a mouse model of HCC.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP0609 |
| Pricing | Inquire |
| Cas | 13063-04-2 |
| Molecular Weight | 383.83 |
| Molecular Formula | C21H18ClNO4 |
| Canonical SMILES | C[N+]1=CC2=CC(=C(C=C2C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC)OC.[Cl-] |