3-BUTOXYBENZENEBORONIC ACID
3-BUTOXYBENZENEBORONIC ACID is a biochemical compound widely used in the biomedical industry. It acts as a crucial reagent in the synthesis of pharmaceutical drugs targeting various diseases, including cancer and inflammatory disorders. With its boronic acid functional group, it facilitates the development of innovative therapies and research in biomedicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 352534-81-7 |
| Pricing | Inquire |
| Cas | 352534-81-7 |
| Molecular Weight | 194.04 |
| Molecular Formula | C10H15BO3 |
| Canonical SMILES | B(C1=CC(=CC=C1)OCCCC)(O)O |