Resorufin b-D-glucuronide sodium salt
Resorufin b-D-glucuronide sodium salt is a powerful tool in the biomedical field utilized as a substrate to investigate glucuronidase enzyme activity and study liver diseases like Gilbert syndrome and Crigler-Najjar syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | 125440-91-7 |
| Pricing | Inquire |
| Cas | 125440-91-7 |
| Molecular Weight | 411.29 |
| Molecular Formula | C18H14NNaO9 |
| Canonical SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)C(=O)[O-])O)O)O)OC4=CC(=O)C=CC4=N2.[Na+] |