FIIN-3
FIIN-3 is a potent, selective, irreversible and the next-generation covalent FGFR inhibitor. FIIN-3 is the first inhibitor that can potently inhibit the proliferation of cells dependent upon the gatekeeper mutants of FGFR1 or FGFR2, which confer resistance to first-generation clinical FGFR inhibitors such as NVP-BGJ398 and AZD4547.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-470888 |
| Pricing | Inquire |
| Cas | 1637735-84-2 |
| Molecular Weight | 691.61 |
| Molecular Formula | C34H36Cl2N8O4 |
| Canonical SMILES | O=C(NC1=CC=C(C=C1)CN(C(NC2=C(C(OC)=CC(OC)=C2Cl)Cl)=O)C3=CC(NC4=CC=C(C=C4)N5CCN(CC5)C)=NC=N3)C=C |