4-Methylumbelliferyl N-acetyl-4,7,8,9-tetra-O-acetyl-a-D-neuraminic acid methyl ester
4-Methylumbelliferyl N-acetyl-4,7,8,9-tetra-O-acetyl-a-D-neuraminic acid methyl ester is an indispensable compound, serving as a vital facilitator within laboratory settings for intricate investigations pertaining to sialic acid metabolism and enzymatic functionalities. Its overwhelming presence primarily revolves around the evaluation of neuraminidase activity, thereby contributing to the comprehensive assessment of the effectiveness of pharmaceutical interventions during viral afflictions, such as influenza.
| Supplier | BOC Sciences |
|---|---|
| Product # | 59361-08-9 |
| Pricing | Inquire |
| Cas | 59361-08-9 |
| Molecular Weight | 649.6 |
| Molecular Formula | C30H35NO15 |
| Canonical SMILES | CC1=CC(OC2=C1C=CC(=C2)O)OC3(CC(C(C(O3)C(C(COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C)OC(=O)C)C(=O)OC |