5-Methoxyindole-3-carboxylic Acid
5-Methoxyindole-3-carboxylic Acid can be used in the synthesis of benzoheterocycle derivatives as vascular endothelial growth factor receptor-2 tyrosine kinase inhibitors and in the synthesis of indoleamine 2,3-dioxygenase 1 inhibitors with potential antitumor activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB000852 |
| Pricing | Inquire |
| Cas | 10242-01-0 |
| Molecular Weight | 191.18 |
| Molecular Formula | C10H9NO3 |
| Canonical SMILES | COC1=CC2=C(C=C1)NC=C2C(=O)O |