2,5-Difluorobenzylzinc chloride solution
2,5-Difluorobenzylzinc chloride solution is a specialized reagent used in the biomedical industry. It's primarily applied in organic synthesis of pharmaceuticals, aiding the manufacture of certain antifungal and antibacterial drugs aimed at treating infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 312692-89-0 |
| Pricing | Inquire |
| Cas | 312692-89-0 |
| Molecular Weight | 227.95 |
| Molecular Formula | F2C6H3CH2ZnCl |
| Canonical SMILES | [CH2-]C1=C(C=CC(=C1)F)F.Cl[Zn+] |