N-Benzoyl-5'-O-trityladenosine
N-Benzoyl-5'-O-trityladenosine, a chemical compound frequently utilized as an intermediate in pharmaceutical synthesis, is well known for its antitumor, antiviral, and anti-inflammatory properties. Its rendering abilities facilitate the propagation of biorelevant molecules such as acyclovir and ganciclovir and construction of nucleoside analogs vital in the management of cancer and other viral illnesses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18404-90-5 |
| Pricing | Inquire |
| Cas | 18404-90-5 |
| Molecular Weight | 613.67 |
| Molecular Formula | C36H31N5O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)COC(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)O)O |