(S)-Esmolol Acid
(S)-Esmolol Acid is an impurity of Esmolol. Esmolol is a cardioselective β-blocker which has a rapid onset but short duration of action without causing significant intrinsic sympathomimetic or membrane stabilizing activities at recommended therapeutic doses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 910651-36-4 |
| Pricing | Inquire |
| Cas | 910651-36-4 |
| Molecular Weight | 281.35 |
| Molecular Formula | C15H23NO4 |
| Canonical SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCC(=O)O)O |