Fmoc-Val-Ala-OH
Fmoc-Val-Ala-OH is a widely used cleavable peptide linker that can conveniently serve as a building block for the careful construction of peptide-directed therapeutics and pharmaceuticals. Its multifaceted nature holds great promise in combating a range of diseases, including but not limited to neoplastic diseases, autoimmune diseases, and potential infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-002431 |
| Pricing | Inquire |
| Cas | 150114-97-9 |
| Molecular Weight | 410.46 |
| Molecular Formula | C23H26N2O5 |
| Canonical SMILES | CC(C)C(C(=O)NC(C)C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |