γ-Cyclodextrin
| Supplier | CD Formulation |
|---|---|
| Product # | CDC10-0110 |
| CAS # | 241-482-4 |
| Pricing | , Inquire for price |
| product1 | Cosmetic Ingredients |
| Molecular Formula | C48H80O40 |
| Synonyms | gamma-Cyclodextrin, Cyclomaltooctaose, Cyclooctaamylose, Schardinger γ-Dextrin |
| CAS Number | 17465-86-0 |
| Category | Cosmetic Chelating Chemicals |
| Purity | ≥98% |
| Color | White |
| Physical State | Powder |
| Solubility | 1 M NaOH: 25 mg/mL, may be clear to slightly hazy |
| Quality Level | 200.0 |
| Storage | room temp |
| Boiling Point | 845.2°C (rough estimate) |
| Melting Point | ≥300 °C |
| Density | 1.2064 g/cm3 (rough estimate) |
| Molecular Weight (g/mol) | 1297.12 |
| Flash Point | 450℃ |
| MDL number | MFCD00009595 |
| NACRES | NA.22 |
| Refractive Index | 1.7500 (estimate) |
| InChI Key | GDSRMADSINPKSL-HSEONFRVSA-N |
| SMILES | [H][C@]1(O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@@H]2[C@@H](COC(C)=O)O[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O |
| InChI | 1S/C48H80O40/c49-1-9-33-17(57)25(65)41(73-9)82-34-10(2-50)75-43(27(67)19(34)59)84-36-12(4-52)77-45(29(69)21(36)61)86-38-14(6-54)79-47(31(71)23(38)63)88-40-16(8-56)80-48(32(72)24(40)64)87-39-15(7-55)78-46(30(70)22(39)62)85-37-13(5-53)76-44(28(68)20(37)60)83-35-11(3-51)74-42(81-33)26(66)18(35)58/h9-72H,1-8H2/t9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48-/m1/s1 |
| Stability | Hygroscopic |
| Hazard Codes | Xi |
| Safety Statements | 26-36-24/25-22 |
| WGK Germany | 2.0 |
| RTECS | GU2293080 |
| HS Code | 29400000.0 |
| Water Solubility | 232 g/L(25 ºC) |
| Image | 17465-86-0 |